C22H30N4O3 — CID 8620861
N-(2-ethylphenyl)-2-[4-[2-[furan-2-ylmethyl(methyl)amino]acetyl]piperazin-1-yl]acetamide (PubChem CID 8620861) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[2-[furan-2-ylmethyl(methyl)amino]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[2-[furan-2-ylmethyl(methyl)amino]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8620861 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[2-[furan-2-ylmethyl(methyl)amino]acetyl]piperazin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)CN(C)Cc2ccco2)CC1 |
| InChI | InChI=1S/C22H30N4O3/c1-3-18-7-4-5-9-20(18)23-21(27)16-25-10-12-26(13-11-25)22(28)17-24(2)15-19-8-6-14-29-19/h4-9,14H,3,10-13,15-17H2,1-2H3,(H,23,27) |
| InChIKey | GJBUQXGLUUXHHG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |