C20H32N4O5S — CID 71913315
N-(2-ethylphenyl)-2-[4-[2-(3-methoxypropylsulfonylamino)acetyl]piperazin-1-yl]acetamide (PubChem CID 71913315) has the molecular formula C20H32N4O5S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[2-(3-methoxypropylsulfonylamino)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[2-(3-methoxypropylsulfonylamino)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 71913315 |
| Molecular Formula | C20H32N4O5S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[2-(3-methoxypropylsulfonylamino)acetyl]piperazin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)CNS(=O)(=O)CCCOC)CC1 |
| InChI | InChI=1S/C20H32N4O5S/c1-3-17-7-4-5-8-18(17)22-19(25)16-23-9-11-24(12-10-23)20(26)15-21-30(27,28)14-6-13-29-2/h4-5,7-8,21H,3,6,9-16H2,1-2H3,(H,22,25) |
| InChIKey | HQFYLYBJEDXWTP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|