C18H27N3O5S — CID 71846024
1-[2-(3-methoxypropylsulfonylamino)acetyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 71846024) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[2-(3-methoxypropylsulfonylamino)acetyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(3-methoxypropylsulfonylamino)acetyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 71846024 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[2-(3-methoxypropylsulfonylamino)acetyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | COCCCS(=O)(=O)NCC(=O)N1CCC(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O5S/c1-26-12-5-13-27(24,25)19-14-17(22)21-10-8-15(9-11-21)18(23)20-16-6-3-2-4-7-16/h2-4,6-7,15,19H,5,8-14H2,1H3,(H,20,23) |
| InChIKey | JAQGCHBKEPKLEX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|