C22H34N4O3 — CID 39439879
2-[4-(6-acetamidohexanoyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 39439879) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[4-(6-acetamidohexanoyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-(6-acetamidohexanoyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 39439879 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 2-[4-(6-acetamidohexanoyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)CCCCCNC(C)=O)CC1 |
| InChI | InChI=1S/C22H34N4O3/c1-3-19-9-6-7-10-20(19)24-21(28)17-25-13-15-26(16-14-25)22(29)11-5-4-8-12-23-18(2)27/h6-7,9-10H,3-5,8,11-17H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | ZHVPWOQKMHEYAC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|