C18H22N2O4S2 — CID 46378261
N-(3-methoxypropyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide (PubChem CID 46378261) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46378261 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(3-methoxypropyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide |
| SMILES | COCCCNC(=O)C1(c2ccc(NS(=O)(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-24-12-3-11-19-17(21)18(9-10-18)14-5-7-15(8-6-14)20-26(22,23)16-4-2-13-25-16/h2,4-8,13,20H,3,9-12H2,1H3,(H,19,21) |
| InChIKey | VUOXHXZIKKKTKU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|