C17H20N2O4S2 — CID 46378235
N-(2-methoxyethyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide (PubChem CID 46378235) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46378235 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(2-methoxyethyl)-1-[4-(thiophen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide |
| SMILES | COCCNC(=O)C1(c2ccc(NS(=O)(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-23-11-10-18-16(20)17(8-9-17)13-4-6-14(7-5-13)19-25(21,22)15-3-2-12-24-15/h2-7,12,19H,8-11H2,1H3,(H,18,20) |
| InChIKey | JULHJKUXFLEANX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|