C13H14N2O3S2 — CID 52992954
N-(2-oxothiolan-3-yl)-1-(thiophene-2-carbonyl)azetidine-3-carboxamide (PubChem CID 52992954) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(2-oxothiolan-3-yl)-1-(thiophene-2-carbonyl)azetidine-3-carboxamide.
| Compound Name | N-(2-oxothiolan-3-yl)-1-(thiophene-2-carbonyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 52992954 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-(2-oxothiolan-3-yl)-1-(thiophene-2-carbonyl)azetidine-3-carboxamide |
| SMILES | O=C(NC1CCSC1=O)C1CN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C13H14N2O3S2/c16-11(14-9-3-5-20-13(9)18)8-6-15(7-8)12(17)10-2-1-4-19-10/h1-2,4,8-9H,3,5-7H2,(H,14,16) |
| InChIKey | QHNSYHJGFXROBU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|