C14H19NO4S — CID 105345698
2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]propanoic acid (PubChem CID 105345698) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 105345698 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CN2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-11(14(16)17)13-4-2-12(3-5-13)10-15-6-8-20(18,19)9-7-15/h2-5,11H,6-10H2,1H3,(H,16,17) |
| InChIKey | LXMDKBMPWXJMOW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |