C16H23NO3 — CID 105345641
2-[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]propanoic acid (PubChem CID 105345641) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 105345641 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CN2CCC(CO)CC2)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-12(16(19)20)15-4-2-13(3-5-15)10-17-8-6-14(11-18)7-9-17/h2-5,12,14,18H,6-11H2,1H3,(H,19,20) |
| InChIKey | TYWGOXSKQYZCSL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |