C13H18BrNO — CID 170919244
4-[(4-bromo-3,5-dimethylphenyl)methyl]morpholine (PubChem CID 170919244) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 4-[(4-bromo-3,5-dimethylphenyl)methyl]morpholine.
| Compound Name | 4-[(4-bromo-3,5-dimethylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 170919244 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-[(4-bromo-3,5-dimethylphenyl)methyl]morpholine |
| SMILES | Cc1cc(CN2CCOCC2)cc(C)c1Br |
| InChI | InChI=1S/C13H18BrNO/c1-10-7-12(8-11(2)13(10)14)9-15-3-5-16-6-4-15/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | XDYAGITWTFUWQF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |