C13H18FNO4S — CID 154879948
4-[(4-fluorosulfonyloxy-3,5-dimethylphenyl)methyl]morpholine (PubChem CID 154879948) has the molecular formula C13H18FNO4S and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[(4-fluorosulfonyloxy-3,5-dimethylphenyl)methyl]morpholine.
| Compound Name | 4-[(4-fluorosulfonyloxy-3,5-dimethylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 154879948 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-[(4-fluorosulfonyloxy-3,5-dimethylphenyl)methyl]morpholine |
| SMILES | Cc1cc(CN2CCOCC2)cc(C)c1OS(=O)(=O)F |
| InChI | InChI=1S/C13H18FNO4S/c1-10-7-12(9-15-3-5-18-6-4-15)8-11(2)13(10)19-20(14,16)17/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | XOGQAPXJBJFRIC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |