C14H17F5N2 — CID 114961207
[4-methyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidin-3-yl]methanamine (PubChem CID 114961207) has the molecular formula C14H17F5N2 and a molecular weight of 308.29 g/mol. Its IUPAC name is [4-methyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidin-3-yl]methanamine.
| Compound Name | [4-methyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 114961207 |
| Molecular Formula | C14H17F5N2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [4-methyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidin-3-yl]methanamine |
| SMILES | CC1CCN(Cc2c(F)c(F)c(F)c(F)c2F)CC1CN |
| InChI | InChI=1S/C14H17F5N2/c1-7-2-3-21(5-8(7)4-20)6-9-10(15)12(17)14(19)13(18)11(9)16/h7-8H,2-6,20H2,1H3 |
| InChIKey | FNZDKVHOXZSWEG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|