C14H23N2P — CID 166885584
(3R)-N,N-dimethyl-1-[(2-methyl-6-phosphanylphenyl)methyl]pyrrolidin-3-amine (PubChem CID 166885584) has the molecular formula C14H23N2P and a molecular weight of 250.33 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-1-[(2-methyl-6-phosphanylphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | (3R)-N,N-dimethyl-1-[(2-methyl-6-phosphanylphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 166885584 |
| Molecular Formula | C14H23N2P |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3R)-N,N-dimethyl-1-[(2-methyl-6-phosphanylphenyl)methyl]pyrrolidin-3-amine |
| SMILES | Cc1cccc(P)c1CN1CC[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C14H23N2P/c1-11-5-4-6-14(17)13(11)10-16-8-7-12(9-16)15(2)3/h4-6,12H,7-10,17H2,1-3H3/t12-/m1/s1 |
| InChIKey | LOAGKCPAFGGGGZ-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|