About 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one
6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one (PubChem CID 68593049) has the molecular formula C22H23F2N3O
and a molecular weight of 383.44 g/mol. Its IUPAC name is 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one |
| PubChem CID | 68593049 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one |
| SMILES | Cc1ccc(CN2CCCC(Nc3ccc4c(=O)[nH]ccc4c3)C2)c(F)c1F |
| InChI | InChI=1S/C22H23F2N3O/c1-14-4-5-16(21(24)20(14)23)12-27-10-2-3-18(13-27)26-17-6-7-19-15(11-17)8-9-25-22(19)28/h4-9,11,18,26H,2-3,10,12-13H2,1H3,(H,25,28) |
| InChIKey | NHGGYLFFSRPSLW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one?
The IUPAC name of 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one (CID 68593049) is 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one.
What is the SMILES notation for 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one?
The canonical SMILES for 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one is Cc1ccc(CN2CCCC(Nc3ccc4c(=O)[nH]ccc4c3)C2)c(F)c1F.
What is the InChIKey of 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one?
The InChIKey is NHGGYLFFSRPSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2N3O/c1-14-4-5-16(21(24)20(14)23)12-27-10-2-3-18(13-27)26-17-6-7-19-15(11-17)8-9-25-22(19)28/h4-9,11,18,26H,2-3,10,12-13H2,1H3,(H,25,28).
What are the key properties of 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one?
6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one has a molecular weight of 383.44 g/mol, XLogP of 4.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[1-[(2,3-difluoro-4-methylphenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one is sourced from PubChem (CID 68593049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).