C25H25N3O — CID 59290703
6-[[(3R)-1-(naphthalen-2-ylmethyl)piperidin-3-yl]amino]-2H-isoquinolin-1-one (PubChem CID 59290703) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 6-[[(3R)-1-(naphthalen-2-ylmethyl)piperidin-3-yl]amino]-2H-isoquinolin-1-one.
| Compound Name | 6-[[(3R)-1-(naphthalen-2-ylmethyl)piperidin-3-yl]amino]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 59290703 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 6-[[(3R)-1-(naphthalen-2-ylmethyl)piperidin-3-yl]amino]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2cc(N[C@@H]3CCCN(Cc4ccc5ccccc5c4)C3)ccc12 |
| InChI | InChI=1S/C25H25N3O/c29-25-24-10-9-22(15-21(24)11-12-26-25)27-23-6-3-13-28(17-23)16-18-7-8-19-4-1-2-5-20(19)14-18/h1-2,4-5,7-12,14-15,23,27H,3,6,13,16-17H2,(H,26,29)/t23-/m1/s1 |
| InChIKey | ZSBDOLYNOZIZQM-HSZRJFAPSA-N |
| XLogP | 4.76 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |