C21H21Cl2N3O — CID 68591678
6-[[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one (PubChem CID 68591678) has the molecular formula C21H21Cl2N3O and a molecular weight of 402.33 g/mol. Its IUPAC name is 6-[[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one.
| Compound Name | 6-[[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 68591678 |
| Molecular Formula | C21H21Cl2N3O |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 6-[[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]amino]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2cc(NC3CCCN(Cc4ccc(Cl)cc4Cl)C3)ccc12 |
| InChI | InChI=1S/C21H21Cl2N3O/c22-16-4-3-15(20(23)11-16)12-26-9-1-2-18(13-26)25-17-5-6-19-14(10-17)7-8-24-21(19)27/h3-8,10-11,18,25H,1-2,9,12-13H2,(H,24,27) |
| InChIKey | ZQZPUURGPVPVKF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |