About 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine
3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine (PubChem CID 62533166) has the molecular formula C13H18F2N2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine |
| PubChem CID | 62533166 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine |
| SMILES | CC1CCCC(Nc2c(N)ccc(F)c2F)C1 |
| InChI | InChI=1S/C13H18F2N2/c1-8-3-2-4-9(7-8)17-13-11(16)6-5-10(14)12(13)15/h5-6,8-9,17H,2-4,7,16H2,1H3 |
| InChIKey | MUHPXEOFBGJXFM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine?
The IUPAC name of 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine (CID 62533166) is 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine.
What is the SMILES notation for 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine?
The canonical SMILES for 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine is CC1CCCC(Nc2c(N)ccc(F)c2F)C1.
What is the InChIKey of 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine?
The InChIKey is MUHPXEOFBGJXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2/c1-8-3-2-4-9(7-8)17-13-11(16)6-5-10(14)12(13)15/h5-6,8-9,17H,2-4,7,16H2,1H3.
What are the key properties of 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine?
3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine has a molecular weight of 240.30 g/mol, XLogP of 3.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoro-2-N-(3-methylcyclohexyl)benzene-1,2-diamine is sourced from PubChem (CID 62533166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).