C11H14F2N2OS — CID 113479698
3,4-difluoro-2-N-(1-oxothian-4-yl)benzene-1,2-diamine (PubChem CID 113479698) has the molecular formula C11H14F2N2OS and a molecular weight of 260.31 g/mol. Its IUPAC name is 3,4-difluoro-2-N-(1-oxothian-4-yl)benzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N-(1-oxothian-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 113479698 |
| Molecular Formula | C11H14F2N2OS |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3,4-difluoro-2-N-(1-oxothian-4-yl)benzene-1,2-diamine |
| SMILES | Nc1ccc(F)c(F)c1NC1CCS(=O)CC1 |
| InChI | InChI=1S/C11H14F2N2OS/c12-8-1-2-9(14)11(10(8)13)15-7-3-5-17(16)6-4-7/h1-2,7,15H,3-6,14H2 |
| InChIKey | ONHYEVXWYFYOQJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|