C10H12N2O2S — CID 3044067
1,3,3a,4,9,9a-hexahydrothieno[3,4-b]quinoxaline 2,2-dioxide (PubChem CID 3044067) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1,3,3a,4,9,9a-hexahydrothieno[3,4-b]quinoxaline 2,2-dioxide.
| Compound Name | 1,3,3a,4,9,9a-hexahydrothieno[3,4-b]quinoxaline 2,2-dioxide |
|---|---|
| PubChem CID | 3044067 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1,3,3a,4,9,9a-hexahydrothieno[3,4-b]quinoxaline 2,2-dioxide |
| SMILES | O=S1(=O)CC2Nc3ccccc3NC2C1 |
| InChI | InChI=1S/C10H12N2O2S/c13-15(14)5-9-10(6-15)12-8-4-2-1-3-7(8)11-9/h1-4,9-12H,5-6H2 |
| InChIKey | NWKHHQLOAXTGLM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|