C14H20N2O6S — CID 119964891
dimethyl 5-[3-(methylamino)propylsulfamoyl]benzene-1,3-dicarboxylate (PubChem CID 119964891) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is dimethyl 5-[3-(methylamino)propylsulfamoyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-(methylamino)propylsulfamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 119964891 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | dimethyl 5-[3-(methylamino)propylsulfamoyl]benzene-1,3-dicarboxylate |
| SMILES | CNCCCNS(=O)(=O)c1cc(C(=O)OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H20N2O6S/c1-15-5-4-6-16-23(19,20)12-8-10(13(17)21-2)7-11(9-12)14(18)22-3/h7-9,15-16H,4-6H2,1-3H3 |
| InChIKey | TWJAUOXGUDIZQF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|