C15H15F6NO5S — CID 101486621
ethyl 3-[[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]methyl]-4-oxobutanoate (PubChem CID 101486621) has the molecular formula C15H15F6NO5S and a molecular weight of 435.34 g/mol. Its IUPAC name is ethyl 3-[[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]methyl]-4-oxobutanoate.
| Compound Name | ethyl 3-[[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 101486621 |
| Molecular Formula | C15H15F6NO5S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | ethyl 3-[[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]methyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CC(C=O)CNS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F6NO5S/c1-2-27-13(24)3-9(8-23)7-22-28(25,26)12-5-10(14(16,17)18)4-11(6-12)15(19,20)21/h4-6,8-9,22H,2-3,7H2,1H3 |
| InChIKey | WXQYSWNQDJOKNB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|