C12H16ClF3N2O2S — CID 120713889
3-chloro-N-[(2R)-2-(ethylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 120713889) has the molecular formula C12H16ClF3N2O2S and a molecular weight of 344.79 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-2-(ethylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-[(2R)-2-(ethylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120713889 |
| Molecular Formula | C12H16ClF3N2O2S |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 3-chloro-N-[(2R)-2-(ethylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16ClF3N2O2S/c1-3-17-8(2)7-18-21(19,20)11-5-9(12(14,15)16)4-10(13)6-11/h4-6,8,17-18H,3,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | FGXGHLLRQQGRDF-MRVPVSSYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |