C11H14ClF3N2O2S — CID 120707228
3-chloro-N-[3-(methylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 120707228) has the molecular formula C11H14ClF3N2O2S and a molecular weight of 330.76 g/mol. Its IUPAC name is 3-chloro-N-[3-(methylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-[3-(methylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120707228 |
| Molecular Formula | C11H14ClF3N2O2S |
| Molecular Weight | 330.76 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3-chloro-N-[3-(methylamino)propyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CNCCCNS(=O)(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14ClF3N2O2S/c1-16-3-2-4-17-20(18,19)10-6-8(11(13,14)15)5-9(12)7-10/h5-7,16-17H,2-4H2,1H3 |
| InChIKey | VXJWTZWYIOAYMK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|