C12H17NO5S — CID 16884230
3-(1,3-benzodioxol-5-yloxy)-N-ethylpropane-1-sulfonamide (PubChem CID 16884230) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxy)-N-ethylpropane-1-sulfonamide.
| Compound Name | 3-(1,3-benzodioxol-5-yloxy)-N-ethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 16884230 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxy)-N-ethylpropane-1-sulfonamide |
| SMILES | CCNS(=O)(=O)CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17NO5S/c1-2-13-19(14,15)7-3-6-16-10-4-5-11-12(8-10)18-9-17-11/h4-5,8,13H,2-3,6-7,9H2,1H3 |
| InChIKey | HJAIFXCJTKYAQR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|