C14H21NO5S — CID 25280640
3-(1,3-benzodioxol-5-yloxy)-N-[(2S)-butan-2-yl]propane-1-sulfonamide (PubChem CID 25280640) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxy)-N-[(2S)-butan-2-yl]propane-1-sulfonamide.
| Compound Name | 3-(1,3-benzodioxol-5-yloxy)-N-[(2S)-butan-2-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 25280640 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxy)-N-[(2S)-butan-2-yl]propane-1-sulfonamide |
| SMILES | CC[C@H](C)NS(=O)(=O)CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H21NO5S/c1-3-11(2)15-21(16,17)8-4-7-18-12-5-6-13-14(9-12)20-10-19-13/h5-6,9,11,15H,3-4,7-8,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | NNRYUCWACBNGQE-NSHDSACASA-N |
| XLogP | 1.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|