C14H13NO6S2 — CID 130460984
4-(1,3-benzodioxol-5-ylmethylsulfamoyl)benzenesulfinic acid (PubChem CID 130460984) has the molecular formula C14H13NO6S2 and a molecular weight of 355.39 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylsulfamoyl)benzenesulfinic acid.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylsulfamoyl)benzenesulfinic acid |
|---|---|
| PubChem CID | 130460984 |
| Molecular Formula | C14H13NO6S2 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylsulfamoyl)benzenesulfinic acid |
| SMILES | O=S(O)c1ccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C14H13NO6S2/c16-22(17)11-2-4-12(5-3-11)23(18,19)15-8-10-1-6-13-14(7-10)21-9-20-13/h1-7,15H,8-9H2,(H,16,17) |
| InChIKey | MVOQVOGECLHYQO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|