C16H16N2O6S — CID 25237237
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2,4-dimethoxybenzenesulfonamide (PubChem CID 25237237) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 25237237 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C\c2ccc3c(c2)OCO3)c(OC)c1 |
| InChI | InChI=1S/C16H16N2O6S/c1-21-12-4-6-16(15(8-12)22-2)25(19,20)18-17-9-11-3-5-13-14(7-11)24-10-23-13/h3-9,18H,10H2,1-2H3/b17-9- |
| InChIKey | BKDHACRYHMQGLI-MFOYZWKCSA-N |
| XLogP | 1.74 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|