C19H22N2O8S — CID 17310876
[4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 17310876) has the molecular formula C19H22N2O8S and a molecular weight of 438.46 g/mol. Its IUPAC name is [4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 17310876 |
| Molecular Formula | C19H22N2O8S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1ccc(S(=O)(=O)N/N=C/c2cc(OC)c(OC(C)=O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O8S/c1-12(22)29-19-16(27-4)8-13(9-17(19)28-5)11-20-21-30(23,24)18-7-6-14(25-2)10-15(18)26-3/h6-11,21H,1-5H3/b20-11+ |
| InChIKey | FJDVUPHUQMXTDE-RGVLZGJSSA-N |
| XLogP | 1.96 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|