C25H26N2O8S — CID 17310903
[4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate (PubChem CID 17310903) has the molecular formula C25H26N2O8S and a molecular weight of 514.56 g/mol. Its IUPAC name is [4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 17310903 |
| Molecular Formula | C25H26N2O8S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | [4-[(E)-[(2,4-dimethoxyphenyl)sulfonylhydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(/C=N/NS(=O)(=O)c2ccc(OC)cc2OC)ccc1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H26N2O8S/c1-5-34-22-14-17(6-12-21(22)35-25(28)18-7-9-19(31-2)10-8-18)16-26-27-36(29,30)24-13-11-20(32-3)15-23(24)33-4/h6-16,27H,5H2,1-4H3/b26-16+ |
| InChIKey | NZWFXHZUOJUKNY-WGOQTCKBSA-N |
| XLogP | 3.64 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|