C26H28N2O6S — CID 4089635
[2-ethoxy-4-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate (PubChem CID 4089635) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is [2-ethoxy-4-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate.
| Compound Name | [2-ethoxy-4-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 4089635 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [2-ethoxy-4-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(C=NNS(=O)(=O)c3ccc(C)cc3)cc2OCC)cc1 |
| InChI | InChI=1S/C26H28N2O6S/c1-4-16-33-22-11-9-21(10-12-22)26(29)34-24-15-8-20(17-25(24)32-5-2)18-27-28-35(30,31)23-13-6-19(3)7-14-23/h6-15,17-18,28H,4-5,16H2,1-3H3 |
| InChIKey | NADSYUBZYXFPGI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|