C24H23BrN2O5S — CID 3850683
[4-bromo-2-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate (PubChem CID 3850683) has the molecular formula C24H23BrN2O5S and a molecular weight of 531.43 g/mol. Its IUPAC name is [4-bromo-2-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate.
| Compound Name | [4-bromo-2-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 3850683 |
| Molecular Formula | C24H23BrN2O5S |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | [4-bromo-2-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(Br)cc2C=NNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23BrN2O5S/c1-3-14-31-21-9-6-18(7-10-21)24(28)32-23-13-8-20(25)15-19(23)16-26-27-33(29,30)22-11-4-17(2)5-12-22/h4-13,15-16,27H,3,14H2,1-2H3 |
| InChIKey | KAGSXLNFLIGNJS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|