C24H26N2O6S — CID 17310896
2,4-dimethoxy-N-[(E)-[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzenesulfonamide (PubChem CID 17310896) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(E)-[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[(E)-[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 17310896 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2,4-dimethoxy-N-[(E)-[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C/c2ccc(OC)c(OCc3cccc(C)c3)c2)c(OC)c1 |
| InChI | InChI=1S/C24H26N2O6S/c1-17-6-5-7-19(12-17)16-32-22-13-18(8-10-21(22)30-3)15-25-26-33(27,28)24-11-9-20(29-2)14-23(24)31-4/h5-15,26H,16H2,1-4H3/b25-15+ |
| InChIKey | CZLPORKGZCVZFX-MFKUBSTISA-N |
| XLogP | 3.91 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|