C8H14N4O2S — CID 115300228
N-methyl-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-amine (PubChem CID 115300228) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is N-methyl-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-amine.
| Compound Name | N-methyl-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115300228 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | N-methyl-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-amine |
| SMILES | CNC1CCN(S(=O)(=O)c2cn[nH]c2)C1 |
| InChI | InChI=1S/C8H14N4O2S/c1-9-7-2-3-12(6-7)15(13,14)8-4-10-11-5-8/h4-5,7,9H,2-3,6H2,1H3,(H,10,11) |
| InChIKey | AYLILKHKZLVHHC-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |