C12H22N4O2S — CID 63854886
N-ethyl-1-[1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]ethanamine (PubChem CID 63854886) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-ethyl-1-[1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]ethanamine.
| Compound Name | N-ethyl-1-[1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 63854886 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-ethyl-1-[1-(1H-pyrazol-4-ylsulfonyl)piperidin-3-yl]ethanamine |
| SMILES | CCNC(C)C1CCCN(S(=O)(=O)c2cn[nH]c2)C1 |
| InChI | InChI=1S/C12H22N4O2S/c1-3-13-10(2)11-5-4-6-16(9-11)19(17,18)12-7-14-15-8-12/h7-8,10-11,13H,3-6,9H2,1-2H3,(H,14,15) |
| InChIKey | MAUPOERESNQMHM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |