C11H13BrCl2N2O2S — CID 120706112
1-(4-bromo-2,3-dichlorophenyl)sulfonylpiperidin-3-amine (PubChem CID 120706112) has the molecular formula C11H13BrCl2N2O2S and a molecular weight of 388.11 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)sulfonylpiperidin-3-amine.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 120706112 |
| Molecular Formula | C11H13BrCl2N2O2S |
| Molecular Weight | 388.11 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)sulfonylpiperidin-3-amine |
| SMILES | NC1CCCN(S(=O)(=O)c2ccc(Br)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/C11H13BrCl2N2O2S/c12-8-3-4-9(11(14)10(8)13)19(17,18)16-5-1-2-7(15)6-16/h3-4,7H,1-2,5-6,15H2 |
| InChIKey | RSMDNJSLRSGVQP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|