C17H21NO3S — CID 39617509
(3S)-1-(4-methoxynaphthalen-1-yl)sulfonyl-3-methylpiperidine (PubChem CID 39617509) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is (3S)-1-(4-methoxynaphthalen-1-yl)sulfonyl-3-methylpiperidine.
| Compound Name | (3S)-1-(4-methoxynaphthalen-1-yl)sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 39617509 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (3S)-1-(4-methoxynaphthalen-1-yl)sulfonyl-3-methylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H](C)C2)c2ccccc12 |
| InChI | InChI=1S/C17H21NO3S/c1-13-6-5-11-18(12-13)22(19,20)17-10-9-16(21-2)14-7-3-4-8-15(14)17/h3-4,7-10,13H,5-6,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | NIIUMPLFCILAPN-ZDUSSCGKSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |