C10H15N3O5S2 — CID 102964425
1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol (PubChem CID 102964425) has the molecular formula C10H15N3O5S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol.
| Compound Name | 1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 102964425 |
| Molecular Formula | C10H15N3O5S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol |
| SMILES | CC1CCN(S(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)CC1O |
| InChI | InChI=1S/C10H15N3O5S2/c1-6-2-3-12(5-8(6)14)20(17,18)9-4-7(13(15)16)10(11)19-9/h4,6,8,14H,2-3,5,11H2,1H3 |
| InChIKey | CCRIBNYYEWBYBK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|