C9H13N3O5S2 — CID 112628557
[1-(5-amino-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol (PubChem CID 112628557) has the molecular formula C9H13N3O5S2 and a molecular weight of 307.35 g/mol. Its IUPAC name is [1-(5-amino-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol.
| Compound Name | [1-(5-amino-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 112628557 |
| Molecular Formula | C9H13N3O5S2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | [1-(5-amino-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanol |
| SMILES | Nc1sc(S(=O)(=O)N2CCC(CO)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O5S2/c10-9-7(12(14)15)3-8(18-9)19(16,17)11-2-1-6(4-11)5-13/h3,6,13H,1-2,4-5,10H2 |
| InChIKey | RBCVQHPJFUBNJQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|