C11H17N3O5S2 — CID 102964500
5-(3-methoxy-4-methylpiperidin-1-yl)sulfonyl-3-nitrothiophen-2-amine (PubChem CID 102964500) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-(3-methoxy-4-methylpiperidin-1-yl)sulfonyl-3-nitrothiophen-2-amine.
| Compound Name | 5-(3-methoxy-4-methylpiperidin-1-yl)sulfonyl-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 102964500 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 5-(3-methoxy-4-methylpiperidin-1-yl)sulfonyl-3-nitrothiophen-2-amine |
| SMILES | COC1CN(S(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)CCC1C |
| InChI | InChI=1S/C11H17N3O5S2/c1-7-3-4-13(6-9(7)19-2)21(17,18)10-5-8(14(15)16)11(12)20-10/h5,7,9H,3-4,6,12H2,1-2H3 |
| InChIKey | ANVZAUQRRBNQDR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|