C11H15ClN2O4S2 — CID 104967304
(2S,6R)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2,6-dimethylpiperidine (PubChem CID 104967304) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is (2S,6R)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2,6-dimethylpiperidine.
| Compound Name | (2S,6R)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 104967304 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | (2S,6R)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C11H15ClN2O4S2/c1-7-4-3-5-8(2)13(7)20(17,18)10-6-9(14(15)16)11(12)19-10/h6-8H,3-5H2,1-2H3/t7-,8+ |
| InChIKey | XGPNFQHWUBJLOJ-OCAPTIKFSA-N |
| XLogP | 3.26 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|