C9H12ClN3O4S2 — CID 82755670
(2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2-methylpiperazine (PubChem CID 82755670) has the molecular formula C9H12ClN3O4S2 and a molecular weight of 325.80 g/mol. Its IUPAC name is (2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2-methylpiperazine.
| Compound Name | (2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2-methylpiperazine |
|---|---|
| PubChem CID | 82755670 |
| Molecular Formula | C9H12ClN3O4S2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | (2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-2-methylpiperazine |
| SMILES | C[C@H]1CNCCN1S(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C9H12ClN3O4S2/c1-6-5-11-2-3-12(6)19(16,17)8-4-7(13(14)15)9(10)18-8/h4,6,11H,2-3,5H2,1H3/t6-/m0/s1 |
| InChIKey | ZUTALVZQMJAGDC-LURJTMIESA-N |
| XLogP | 1.29 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|