C9H9ClN2O6S2 — CID 80742224
(2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 80742224) has the molecular formula C9H9ClN2O6S2 and a molecular weight of 340.77 g/mol. Its IUPAC name is (2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 80742224 |
| Molecular Formula | C9H9ClN2O6S2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | (2S)-1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1S(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C9H9ClN2O6S2/c10-8-6(12(15)16)4-7(19-8)20(17,18)11-3-1-2-5(11)9(13)14/h4-5H,1-3H2,(H,13,14)/t5-/m0/s1 |
| InChIKey | AFAATMIXEBXCTJ-YFKPBYRVSA-N |
| XLogP | 1.55 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|