C12H15ClN2O5S — CID 114678258
1-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperidin-4-ol (PubChem CID 114678258) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperidin-4-ol.
| Compound Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 114678258 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperidin-4-ol |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CCC1O |
| InChI | InChI=1S/C12H15ClN2O5S/c1-8-7-14(5-4-12(8)16)21(19,20)9-2-3-10(13)11(6-9)15(17)18/h2-3,6,8,12,16H,4-5,7H2,1H3 |
| InChIKey | IXERKXDJIUIBIU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|