C12H13ClN2O6S2 — CID 8778004
methyl (2S)-4-(4-chloro-3-nitrophenyl)sulfonylthiomorpholine-2-carboxylate (PubChem CID 8778004) has the molecular formula C12H13ClN2O6S2 and a molecular weight of 380.83 g/mol. Its IUPAC name is methyl (2S)-4-(4-chloro-3-nitrophenyl)sulfonylthiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-(4-chloro-3-nitrophenyl)sulfonylthiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 8778004 |
| Molecular Formula | C12H13ClN2O6S2 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | methyl (2S)-4-(4-chloro-3-nitrophenyl)sulfonylthiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CCS1 |
| InChI | InChI=1S/C12H13ClN2O6S2/c1-21-12(16)11-7-14(4-5-22-11)23(19,20)8-2-3-9(13)10(6-8)15(17)18/h2-3,6,11H,4-5,7H2,1H3/t11-/m0/s1 |
| InChIKey | XIDLNNBJWUYIIJ-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|