C15H18ClN3O5S — CID 9442223
1-(4-chloro-3-nitrophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 9442223) has the molecular formula C15H18ClN3O5S and a molecular weight of 387.85 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 9442223 |
| Molecular Formula | C15H18ClN3O5S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C15H18ClN3O5S/c1-2-7-17-15(20)11-5-8-18(9-6-11)25(23,24)12-3-4-13(16)14(10-12)19(21)22/h2-4,10-11H,1,5-9H2,(H,17,20) |
| InChIKey | NVCOPNLECLYDGN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|