C22H36ClN5O5S — CID 11432340
1-(4-chloro-3-nitrophenyl)sulfonyl-N,N-bis[3-(dimethylamino)propyl]piperidine-3-carboxamide (PubChem CID 11432340) has the molecular formula C22H36ClN5O5S and a molecular weight of 518.08 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)sulfonyl-N,N-bis[3-(dimethylamino)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-N,N-bis[3-(dimethylamino)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11432340 |
| Molecular Formula | C22H36ClN5O5S |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-N,N-bis[3-(dimethylamino)propyl]piperidine-3-carboxamide |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)C1CCCN(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H36ClN5O5S/c1-24(2)11-6-13-26(14-7-12-25(3)4)22(29)18-8-5-15-27(17-18)34(32,33)19-9-10-20(23)21(16-19)28(30)31/h9-10,16,18H,5-8,11-15,17H2,1-4H3 |
| InChIKey | XNYAQJCPBSNWAT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|