C18H20FN3O6S2 — CID 26544783
1-(4-fluorophenyl)sulfonyl-4-(4-methyl-3-nitrophenyl)sulfonyl-1,4-diazepane (PubChem CID 26544783) has the molecular formula C18H20FN3O6S2 and a molecular weight of 457.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-4-(4-methyl-3-nitrophenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-4-(4-methyl-3-nitrophenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 26544783 |
| Molecular Formula | C18H20FN3O6S2 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-4-(4-methyl-3-nitrophenyl)sulfonyl-1,4-diazepane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(F)cc3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20FN3O6S2/c1-14-3-6-17(13-18(14)22(23)24)30(27,28)21-10-2-9-20(11-12-21)29(25,26)16-7-4-15(19)5-8-16/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | SOGFJGYYAKFXAW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|