C10H14ClN3O5S2 — CID 106915188
3-[(5-chloro-4-nitrothiophen-2-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide (PubChem CID 106915188) has the molecular formula C10H14ClN3O5S2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 3-[(5-chloro-4-nitrothiophen-2-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide.
| Compound Name | 3-[(5-chloro-4-nitrothiophen-2-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106915188 |
| Molecular Formula | C10H14ClN3O5S2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 3-[(5-chloro-4-nitrothiophen-2-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)CN(C)S(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C10H14ClN3O5S2/c1-6(10(15)12-2)5-13(3)21(18,19)8-4-7(14(16)17)9(11)20-8/h4,6H,5H2,1-3H3,(H,12,15) |
| InChIKey | PMGAUWPGBMQYFM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|