C11H19N3O5S2 — CID 80731238
N-(2-hydroxypropyl)-N-methyl-4-nitro-5-(propylamino)thiophene-2-sulfonamide (PubChem CID 80731238) has the molecular formula C11H19N3O5S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N-methyl-4-nitro-5-(propylamino)thiophene-2-sulfonamide.
| Compound Name | N-(2-hydroxypropyl)-N-methyl-4-nitro-5-(propylamino)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80731238 |
| Molecular Formula | C11H19N3O5S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-(2-hydroxypropyl)-N-methyl-4-nitro-5-(propylamino)thiophene-2-sulfonamide |
| SMILES | CCCNc1sc(S(=O)(=O)N(C)CC(C)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N3O5S2/c1-4-5-12-11-9(14(16)17)6-10(20-11)21(18,19)13(3)7-8(2)15/h6,8,12,15H,4-5,7H2,1-3H3 |
| InChIKey | HUUWWIZGMOJKGE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|