C8H13N3O5S2 — CID 80746275
N-(2-hydroxyethyl)-N-methyl-5-(methylamino)-4-nitrothiophene-2-sulfonamide (PubChem CID 80746275) has the molecular formula C8H13N3O5S2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-methyl-5-(methylamino)-4-nitrothiophene-2-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-N-methyl-5-(methylamino)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80746275 |
| Molecular Formula | C8H13N3O5S2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-(2-hydroxyethyl)-N-methyl-5-(methylamino)-4-nitrothiophene-2-sulfonamide |
| SMILES | CNc1sc(S(=O)(=O)N(C)CCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H13N3O5S2/c1-9-8-6(11(13)14)5-7(17-8)18(15,16)10(2)3-4-12/h5,9,12H,3-4H2,1-2H3 |
| InChIKey | ZIUBAGGRWYGYJK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|